CAS 898769-00-1

1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methylphenyl)-

Description:

1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methylphenyl)-, also known by its CAS number 898769-00-1, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two aromatic substituents: a 2,3-dimethylphenyl group and a 4-methylphenyl group. This structure contributes to its unique chemical properties, including its potential as a solvent and its reactivity in various organic synthesis reactions. The presence of multiple methyl groups enhances its hydrophobic character, influencing its solubility in organic solvents. Additionally, the compound may exhibit interesting physical properties such as boiling and melting points, which are typical of ketones. Its aromatic substituents can also impart specific electronic characteristics, making it useful in applications such as pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₈H₂₀O

InChI: InChI=1S/C18H20O/c1-13-7-9-17(10-8-13)18(19)12-11-16-6-4-5-14(2)15(16)3/h4-10H,11-12H2,1-3H3

InChI key: InChIKey=ZENNHPKZHIDDKD-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(C)C=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 3-(2,3-Dimethylphenyl)-1-(4-methylphenyl)-1-propanone
• 1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methylphenyl)-
• 3-(2,3-Dimethylphenyl)-4′-methylpropiophenone

3-(2,3-dimethylphenyl)-4′-methylpropiophenone

CAS: 898769-00-1

Formula: C₁₈H₂₀O

Purity: 97.0%

Molecular weight: 252.357

Ref: 10-F206362