CAS 898769-01-2
:3-(p-tolyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one
Description:
3-(p-Tolyl)-1-[3-(trifluoromethyl)phenyl]propan-1-one, identified by its CAS number 898769-01-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with a p-tolyl group (a para-methylphenyl) and a 3-(trifluoromethyl)phenyl substituent, which contributes to its unique chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. Typically, compounds with such structural features may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms often imparts stability and alters the electronic characteristics of the molecule, which can be crucial for its interaction with biological targets. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.
Formula:C17H15F3O
InChI:InChI=1/C17H15F3O/c1-12-5-7-13(8-6-12)9-10-16(21)14-3-2-4-15(11-14)17(18,19)20/h2-8,11H,9-10H2,1H3
SMILES:Cc1ccc(cc1)CCC(=O)c1cccc(c1)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.