CAS 898769-03-4

Cyclohexyl[2-(methylthio)phenyl]methanone

Description:

Cyclohexyl[2-(methylthio)phenyl]methanone is an organic compound characterized by its unique structure, which includes a cyclohexyl group, a phenyl ring substituted with a methylthio group, and a ketone functional group. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic cyclohexyl and phenyl components. The presence of the methylthio group may impart specific chemical reactivity, such as potential nucleophilicity or participation in various substitution reactions. Additionally, the ketone functional group can engage in hydrogen bonding and may influence the compound's reactivity and stability. Cyclohexyl[2-(methylthio)phenyl]methanone may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₁₄H₁₈OS

InChI: InChI=1S/C14H18OS/c1-16-13-10-6-5-9-12(13)14(15)11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3

InChI key: InChIKey=MXGUWSTWWGNBGK-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(SC)C=CC=C1)C2CCCCC2

Synonyms:

• Methanone, cyclohexyl[2-(methylthio)phenyl]-
• Cyclohexyl[2-(methylthio)phenyl]methanone