CAS 898769-04-5

3-(4-Methylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone

Description:

3-(4-Methylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone, also known by its CAS number 898769-04-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic rings: one containing a methyl group and the other a trifluoromethyl group, which significantly influences its chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its reactivity and interaction with biological systems. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in organic synthesis and as intermediates in the production of more complex molecules. Additionally, the compound's stability and solubility characteristics are influenced by the substituents on the aromatic rings, which can affect its behavior in various solvents and under different conditions. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and applications.

Formula: C₁₇H₁₅F₃O

InChI: InChI=1/C17H15F3O/c1-12-2-4-13(5-3-12)6-11-16(21)14-7-9-15(10-8-14)17(18,19)20/h2-5,7-10H,6,11H2,1H3

InChI key: InChIKey=VRQCPXBMGSEYLT-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(C)C=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 1-Propanone, 3-(4-methylphenyl)-1-[4-(trifluoromethyl)phenyl]-
• 3-(4-Methylphenyl)-1-[4-(trifluoromethyl)phenyl]-1-propanone