CAS 898769-06-7
:(3-bromophenyl)-cyclohexyl-methanone
Description:
(3-Bromophenyl)-cyclohexyl-methanone, identified by its CAS number 898769-06-7, is an organic compound characterized by the presence of a cyclohexyl group attached to a methanone (ketone) functional group, along with a bromophenyl substituent. This compound typically exhibits a white to off-white crystalline appearance. The presence of the bromine atom in the phenyl ring can influence its reactivity and solubility, often enhancing its lipophilicity. As a ketone, it features a carbonyl group (C=O), which is polar and can participate in various chemical reactions, such as nucleophilic addition. The compound may also display interesting biological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential hazards associated with brominated compounds.
Formula:C13H15BrO
InChI:InChI=1/C13H15BrO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h4,7-10H,1-3,5-6H2
SMILES:C1CCC(CC1)C(=O)c1cccc(c1)Br
Synonyms:- Methanone, (3-Bromophenyl)Cyclohexyl-
- (3-Bromophenyl)(cyclohexyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.