CAS 898769-08-9

1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methoxyphenyl)-

Description:

1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methoxyphenyl)-, also known by its CAS number 898769-08-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 4-methoxyphenyl group. The presence of the ketone group imparts certain reactivity, making it susceptible to nucleophilic attacks, while the aromatic rings contribute to its stability and potential for various chemical interactions. The methoxy group enhances the compound's solubility in organic solvents and may influence its electronic properties, affecting reactivity and interaction with other molecules. This compound may be of interest in fields such as organic synthesis, pharmaceuticals, or materials science due to its unique structural features. Its physical properties, such as boiling point, melting point, and solubility, would typically be determined through experimental methods, as they can vary based on purity and environmental conditions.

Formula: C₁₈H₂₀O₂

InChI: InChI=1S/C18H20O2/c1-13-5-4-6-15(14(13)2)9-12-18(19)16-7-10-17(20-3)11-8-16/h4-8,10-11H,9,12H2,1-3H3

InChI key: InChIKey=FDBVOKYNVYXAQR-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(OC)C=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 3-(2,3-Dimethylphenyl)-4′-methoxypropiophenone
• 1-Propanone, 3-(2,3-dimethylphenyl)-1-(4-methoxyphenyl)-
• 3-(2,3-Dimethylphenyl)-1-(4-methoxyphenyl)-1-propanone

3-(2,3-dimethylphenyl)-4′-methoxypropiophenone

CAS: 898769-08-9

Formula: C₁₈H₂₀O₂

Purity: 97.0%

Molecular weight: 268.356

Ref: 10-F206365