CAS 898769-11-4

2-[3-(2,3-dimethylphenyl)propanoyl]benzonitrile

Description:

2-[3-(2,3-dimethylphenyl)propanoyl]benzonitrile, with the CAS number 898769-11-4, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a propanoyl group attached to a dimethylphenyl substituent. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for pi-stacking interactions due to its conjugated system. The presence of the nitrile group (-C≡N) contributes to its polarity and can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. Additionally, the dimethylphenyl group may enhance lipophilicity, affecting its solubility in organic solvents. The compound's unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, 2-[3-(2,3-dimethylphenyl)propanoyl]benzonitrile is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₈H₁₇NO

InChI: InChI=1/C18H17NO/c1-13-6-5-8-15(14(13)2)10-11-18(20)17-9-4-3-7-16(17)12-19/h3-9H,10-11H2,1-2H3

SMILES: Cc1cccc(CCC(=O)c2ccccc2C#N)c1C

2′-cyano-3-(2,3-dimethylphenyl)propiophenone

CAS: 898769-11-4

Formula: C₁₈H₁₇NO

Purity: 97.0%

Molecular weight: 263.34

Ref: 10-F206366