CAS 898769-15-8
:Cyclohexyl(2,6-dimethylphenyl)methanone
Description:
Cyclohexyl(2,6-dimethylphenyl)methanone, identified by its CAS number 898769-15-8, is an organic compound characterized by its ketone functional group. It features a cyclohexyl group and a 2,6-dimethylphenyl moiety, contributing to its unique structural properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. Cyclohexyl(2,6-dimethylphenyl)methanone may exhibit interesting chemical reactivity, particularly in electrophilic aromatic substitution reactions due to the presence of the electron-donating methyl groups on the aromatic ring. Additionally, it may serve as an intermediate in organic synthesis or in the production of various chemical products. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Proper storage and handling procedures are essential to ensure safety in laboratory or industrial settings.
Formula:C15H20O
InChI:InChI=1S/C15H20O/c1-11-7-6-8-12(2)14(11)15(16)13-9-4-3-5-10-13/h6-8,13H,3-5,9-10H2,1-2H3
InChI key:InChIKey=UZTFYRZZWCIVSC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC=C1C)C2CCCCC2
Synonyms:- Cyclohexyl(2,6-dimethylphenyl)methanone
- Methanone, cyclohexyl(2,6-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.