CAS 898769-16-9

1-(4-chloro-2-fluoro-phenyl)-3-(p-tolyl)propan-1-one

Description:

1-(4-chloro-2-fluoro-phenyl)-3-(p-tolyl)propan-1-one, with the CAS number 898769-16-9, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 4-chloro-2-fluorophenyl group and a p-tolyl group, which contribute to its unique chemical properties. The presence of halogen atoms, specifically chlorine and fluorine, enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can affect its solubility in organic solvents. Additionally, the molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and reductions. Its specific applications may vary, but compounds with similar structures are often explored for their potential as intermediates in the synthesis of more complex molecules or as active pharmaceutical ingredients. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₁₄ClFO

InChI: InChI=1/C16H14ClFO/c1-11-2-4-12(5-3-11)6-9-16(19)14-8-7-13(17)10-15(14)18/h2-5,7-8,10H,6,9H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)c1ccc(cc1F)Cl

4′-chloro-2′-fluoro-3-(4-methylphenyl)propiophenone

CAS: 898769-16-9

Formula: C₁₆H₁₄ClFO

Purity: 97.0%

Molecular weight: 276.74

Ref: 10-F205761