CAS 898769-18-1

Cyclohexyl(3,5-dimethylphenyl)methanone

Description:

Cyclohexyl(3,5-dimethylphenyl)methanone, identified by its CAS number 898769-18-1, is an organic compound characterized by a cyclohexyl group attached to a ketone functional group, which is further linked to a 3,5-dimethylphenyl moiety. This compound typically exhibits a solid state at room temperature and is likely to be insoluble or poorly soluble in water due to its hydrophobic cyclohexyl and aromatic components. The presence of the ketone functional group suggests that it may participate in various chemical reactions, such as nucleophilic addition or oxidation. Its structure indicates potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to the unique combination of cyclohexyl and aromatic characteristics. Additionally, the compound may exhibit interesting physical properties, such as specific melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₅H₂₀O

InChI: InChI=1/C15H20O/c1-11-8-12(2)10-14(9-11)15(16)13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3

InChI key: InChIKey=BPRJMVMGFVIHLK-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=CC(C)=C1)C2CCCCC2

Synonyms:

• Cyclohexyl(3,5-dimethylphenyl)methanone
• Methanone, cyclohexyl(3,5-dimethylphenyl)-