CAS 898769-24-9

(4-chloro-3-fluoro-phenyl)-cyclohexyl-methanone

Description:

(4-chloro-3-fluoro-phenyl)-cyclohexyl-methanone, with the CAS number 898769-24-9, is an organic compound characterized by its unique structure that includes a cyclohexyl group attached to a phenyl ring substituted with both chlorine and fluorine atoms. This compound typically exhibits properties associated with aromatic ketones, including moderate volatility and potential solubility in organic solvents. The presence of halogen substituents, specifically chlorine and fluorine, can influence its reactivity, stability, and interaction with biological systems, making it of interest in medicinal chemistry and material science. The cyclohexyl moiety contributes to its hydrophobic characteristics, while the aromatic ring can engage in π-π stacking interactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest for various chemical applications.

Formula: C₁₃H₁₄ClFO

InChI: InChI=1/C13H14ClFO/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h6-9H,1-5H2

SMILES: C1CCC(CC1)C(=O)c1ccc(c(c1)F)Cl