CAS 898769-28-3
:1-(3,4-dichlorophenyl)-3-(p-tolyl)propan-1-one
Description:
1-(3,4-Dichlorophenyl)-3-(p-tolyl)propan-1-one, with the CAS number 898769-28-3, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where a dichlorophenyl group and a p-tolyl group are attached to the first and third carbon atoms, respectively. The presence of the dichlorophenyl moiety contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique chemical properties and reactivity. The compound is likely to be a solid at room temperature, given its structural characteristics, and may exhibit moderate solubility in organic solvents. Its synthesis typically involves multi-step organic reactions, which may include Friedel-Crafts acylation or similar methodologies. Due to its structural features, it may be of interest in medicinal chemistry and material science, although specific applications would depend on further research into its biological activity and interactions. Safety and handling precautions should be observed, as with many organic compounds, particularly those containing halogens.
Formula:C16H14Cl2O
InChI:InChI=1/C16H14Cl2O/c1-11-2-4-12(5-3-11)6-9-16(19)13-7-8-14(17)15(18)10-13/h2-5,7-8,10H,6,9H2,1H3
SMILES:Cc1ccc(cc1)CCC(=O)c1ccc(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.