CAS 898769-35-2

1-(3-bromophenyl)-3-(2,3-dimethylphenyl)propan-1-one

Description:

1-(3-bromophenyl)-3-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898769-35-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where a bromophenyl group is attached to one end and a dimethylphenyl group is attached to the other. The presence of the bromine atom introduces notable electronegativity, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The dimethyl substitution on the phenyl ring contributes to steric hindrance, potentially affecting its interactions in chemical reactions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₇H₁₇BrO

InChI: InChI=1/C17H17BrO/c1-12-5-3-6-14(13(12)2)9-10-17(19)15-7-4-8-16(18)11-15/h3-8,11H,9-10H2,1-2H3

SMILES: Cc1cccc(CCC(=O)c2cccc(c2)Br)c1C