CymitQuimica logo

CAS 898769-37-4

:

1-(3,4-difluorophenyl)-3-(p-tolyl)propan-1-one

Description:
1-(3,4-Difluorophenyl)-3-(p-tolyl)propan-1-one, with the CAS number 898769-37-4, is an organic compound characterized by its ketone functional group and the presence of both difluorophenyl and p-tolyl substituents. This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline powder. Its molecular structure suggests it may have moderate to high lipophilicity due to the aromatic rings, which can influence its solubility in organic solvents. The difluorophenyl group introduces electron-withdrawing fluorine atoms, potentially affecting the compound's reactivity and stability. Additionally, the presence of the p-tolyl group may enhance its hydrophobic characteristics. This compound may be of interest in medicinal chemistry and material science, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C16H14F2O
InChI:InChI=1/C16H14F2O/c1-11-2-4-12(5-3-11)6-9-16(19)13-7-8-14(17)15(18)10-13/h2-5,7-8,10H,6,9H2,1H3
SMILES:Cc1ccc(cc1)CCC(=O)c1ccc(c(c1)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.