CAS 898769-38-5

1-Propanone, 1-(4-bromophenyl)-3-(2,3-dimethylphenyl)-

Description:

1-Propanone, 1-(4-bromophenyl)-3-(2,3-dimethylphenyl)-, also known by its CAS number 898769-38-5, is an organic compound characterized by its ketone functional group. It features a propanone backbone with a bromophenyl group at one end and a dimethylphenyl group at the other, contributing to its unique chemical properties. This compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to exhibit moderate solubility in organic solvents due to the presence of both hydrophobic aromatic rings and a polar carbonyl group. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the presence of multiple aromatic rings may impart interesting electronic properties, making it useful in materials science or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₁₇H₁₇BrO

InChI: InChI=1S/C17H17BrO/c1-12-4-3-5-14(13(12)2)8-11-17(19)15-6-9-16(18)10-7-15/h3-7,9-10H,8,11H2,1-2H3

InChI key: InChIKey=KTRIVWVFUGZGCB-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(Br)C=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 4′-Bromo-3-(2,3-dimethylphenyl)propiophenone
• 1-(4-Bromophenyl)-3-(2,3-dimethylphenyl)-1-propanone
• 1-Propanone, 1-(4-bromophenyl)-3-(2,3-dimethylphenyl)-

4′-bromo-3-(2,3-dimethylphenyl)propiophenone

CAS: 898769-38-5

Formula: C₁₇H₁₇BrO

Purity: 97.0%

Molecular weight: 317.226

Ref: 10-F206375