CymitQuimica logo

CAS 898769-43-2

:

1-Propanone, 3-(4-methylphenyl)-1-(3,4,5-trifluorophenyl)-

Description:
1-Propanone, 3-(4-methylphenyl)-1-(3,4,5-trifluorophenyl)-, also known by its CAS number 898769-43-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a para-methylphenyl group and a trifluorophenyl group, which significantly influence its chemical properties. The presence of the trifluoromethyl groups enhances its lipophilicity and may impart unique reactivity patterns, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate volatility and solubility in organic solvents, while its stability can be affected by the presence of the electronegative fluorine atoms. Additionally, the compound's structure suggests potential for engaging in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the trifluoromethyl group. Overall, this compound's unique structural features contribute to its potential utility in synthetic chemistry and material science.
Formula:C16H13F3O
InChI:InChI=1S/C16H13F3O/c1-10-2-4-11(5-3-10)6-7-15(20)12-8-13(17)16(19)14(18)9-12/h2-5,8-9H,6-7H2,1H3
InChI key:InChIKey=MRDHZXDHSYGURJ-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(C)C=C1)(=O)C2=CC(F)=C(F)C(F)=C2
Synonyms:
  • 3-(4-Methylphenyl)-3′,4′,5′-trifluoropropiophenone
  • 3-(4-Methylphenyl)-1-(3,4,5-trifluorophenyl)-1-propanone
  • 1-Propanone, 3-(4-methylphenyl)-1-(3,4,5-trifluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.