CAS 898769-47-6

1-Propanone, 3-(2,3-dimethylphenyl)-1-(3-fluorophenyl)-

Description:

1-Propanone, 3-(2,3-dimethylphenyl)-1-(3-fluorophenyl)-, identified by CAS number 898769-47-6, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 3-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in reactivity and solubility. The fluorine atom in the 3-fluorophenyl group can enhance the compound's lipophilicity and influence its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of methyl groups on the aromatic ring can affect steric hindrance and overall molecular stability. As with many organic compounds, its physical properties such as boiling point, melting point, and solubility would depend on the specific interactions between its molecular structure and the surrounding environment.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-5-3-6-14(13(12)2)9-10-17(19)15-7-4-8-16(18)11-15/h3-8,11H,9-10H2,1-2H3

InChI key: InChIKey=ZTXGAAGFSTYCEA-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(F)=CC=C1)C2=C(C)C(C)=CC=C2

Synonyms:

• 3-(2,3-Dimethylphenyl)-1-(3-fluorophenyl)-1-propanone
• 1-Propanone, 3-(2,3-dimethylphenyl)-1-(3-fluorophenyl)-
• 3-(2,3-Dimethylphenyl)-3′-fluoropropiophenone

3-(2,3-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898769-47-6

Formula: C₁₇H₁₇FO

Purity: 97.0%

Molecular weight: 256.32

Ref: 10-F206378