CAS 898769-50-1
:3-(2,3-dimethylphenyl)-1-(4-fluorophenyl)propan-1-one
Description:
3-(2,3-Dimethylphenyl)-1-(4-fluorophenyl)propan-1-one, with the CAS number 898769-50-1, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the carbonyl group (C=O). This compound features a propanone backbone substituted with two distinct aromatic groups: a 2,3-dimethylphenyl group and a 4-fluorophenyl group. The presence of the fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties and reactivity. The dimethyl substitutions on the other phenyl ring enhance steric hindrance, potentially affecting the compound's physical properties such as melting and boiling points, as well as its solubility in various solvents. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for structural confirmation. Overall, this compound represents a complex structure with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C17H17FO
InChI:InChI=1/C17H17FO/c1-12-4-3-5-14(13(12)2)8-11-17(19)15-6-9-16(18)10-7-15/h3-7,9-10H,8,11H2,1-2H3
SMILES:Cc1cccc(CCC(=O)c2ccc(cc2)F)c1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.