CAS 898769-53-4

1,3-bis(2,3-dimethylphenyl)propan-1-one

Description:

1,3-bis(2,3-dimethylphenyl)propan-1-one, identified by its CAS number 898769-53-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two 2,3-dimethylphenyl groups attached to the first and third carbon atoms. It is typically a solid at room temperature and may exhibit a crystalline structure. The presence of the bulky dimethylphenyl groups contributes to its relatively high molecular weight and influences its solubility properties, making it more soluble in organic solvents than in water. This compound is often utilized in organic synthesis and may serve as a photoinitiator in polymerization processes. Its chemical stability and reactivity can be influenced by the steric hindrance provided by the dimethyl groups, which can affect its interactions with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₉H₂₂O

InChI: InChI=1/C19H22O/c1-13-7-5-9-17(15(13)3)11-12-19(20)18-10-6-8-14(2)16(18)4/h5-10H,11-12H2,1-4H3

SMILES: Cc1cccc(CCC(=O)c2cccc(C)c2C)c1C