CAS 898769-54-5
:cyclohexyl-(2,4-difluorophenyl)methanone
Description:
Cyclohexyl-(2,4-difluorophenyl)methanone, with the CAS number 898769-54-5, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a 2,4-difluorophenyl moiety attached to a carbonyl group (ketone). This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the difluorophenyl group suggests that it may possess interesting electronic properties, potentially influencing its reactivity and interactions with other molecules. The fluorine atoms can enhance lipophilicity and alter the compound's polarity, which may affect its solubility in various solvents. Additionally, the cyclohexyl group can contribute to steric hindrance, influencing the compound's behavior in chemical reactions. Due to its structural features, this compound may be of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C13H14F2O
InChI:InChI=1/C13H14F2O/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h6-9H,1-5H2
SMILES:C1CCC(CC1)C(=O)c1ccc(cc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.