CAS 898769-55-6

1-cyclopentyl-3-(p-tolyl)propan-1-one

Description:

1-Cyclopentyl-3-(p-tolyl)propan-1-one, identified by its CAS number 898769-55-6, is an organic compound characterized by its ketone functional group. This substance features a cyclopentyl group and a para-tolyl group attached to a propanone backbone, contributing to its unique structural properties. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the cyclopentyl ring provides a degree of rigidity, while the para-tolyl group enhances its hydrophobic characteristics. This compound is often studied for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the ketone functional group, making it susceptible to nucleophilic attacks and enabling further chemical transformations. Safety data indicates that, like many organic solvents and ketones, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory or industrial settings.

Formula: C₁₅H₂₀O

InChI: InChI=1/C15H20O/c1-12-6-8-13(9-7-12)10-11-15(16)14-4-2-3-5-14/h6-9,14H,2-5,10-11H2,1H3

SMILES: Cc1ccc(cc1)CCC(=O)C1CCCC1