CAS 898769-56-7

Cyclohexyl(3,4-difluorophenyl)methanone

Description:

Cyclohexyl(3,4-difluorophenyl)methanone, identified by its CAS number 898769-56-7, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a 3,4-difluorophenyl moiety attached to a carbonyl group. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the difluorophenyl group, which can enhance biological activity or modify physical properties. The presence of fluorine atoms often contributes to increased lipophilicity and metabolic stability. Additionally, the compound may exhibit specific reactivity patterns typical of ketones, such as undergoing nucleophilic addition reactions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, Cyclohexyl(3,4-difluorophenyl)methanone represents a compound of interest in synthetic organic chemistry and potential applications in various fields.

Formula: C₁₃H₁₄F₂O

InChI: InChI=1S/C13H14F2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h6-9H,1-5H2

InChI key: InChIKey=WXPNSJMJXVOCEH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(F)C=C1)C2CCCCC2

Synonyms:

• Methanone, cyclohexyl(3,4-difluorophenyl)-
• Cyclohexyl(3,4-difluorophenyl)methanone