CymitQuimica logo

CAS 898769-58-9

:

Cyclohexyl(3,5-difluorophenyl)methanone

Description:
Cyclohexyl(3,5-difluorophenyl)methanone, identified by its CAS number 898769-58-9, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a 3,5-difluorophenyl moiety attached to a carbonyl functional group (ketone). This compound typically exhibits a solid-state at room temperature and is likely to be relatively stable under standard conditions. The presence of the difluorophenyl group introduces notable electronic effects, which can influence its reactivity and interactions with other molecules. The cyclohexyl group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility in various solvents. Additionally, the fluorine atoms can enhance the compound's lipophilicity and may impact its biological activity, making it of interest in medicinal chemistry. Overall, Cyclohexyl(3,5-difluorophenyl)methanone is a compound that may be explored for various applications, including pharmaceuticals and agrochemicals, due to its structural features and potential reactivity.
Formula:C13H14F2O
InChI:InChI=1S/C13H14F2O/c14-11-6-10(7-12(15)8-11)13(16)9-4-2-1-3-5-9/h6-9H,1-5H2
InChI key:InChIKey=GKEGXRUFPBGGPQ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=CC(F)=C1)C2CCCCC2
Synonyms:
  • Cyclohexyl(3,5-difluorophenyl)methanone
  • Methanone, cyclohexyl(3,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.