CAS 898769-60-3
:Cyclohexyl(3,4,5-trifluorophenyl)methanone
Description:
Cyclohexyl(3,4,5-trifluorophenyl)methanone, with the CAS number 898769-60-3, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a trifluorophenyl moiety attached to a carbonyl functional group. This compound typically exhibits a solid state at room temperature and is likely to be relatively stable under standard conditions. The presence of the trifluoromethyl groups contributes to its lipophilicity and may enhance its biological activity, making it of interest in pharmaceutical research. The carbonyl group (ketone) suggests potential reactivity in nucleophilic addition reactions. Additionally, the trifluorophenyl group can influence the compound's electronic properties, potentially affecting its interactions with biological targets. Due to the fluorine atoms, the compound may also exhibit unique solubility characteristics and thermal stability. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with halogenated groups. Overall, Cyclohexyl(3,4,5-trifluorophenyl)methanone represents a compound of interest in synthetic organic chemistry and medicinal chemistry.
Formula:C13H13F3O
InChI:InChI=1/C13H13F3O/c14-10-6-9(7-11(15)12(10)16)13(17)8-4-2-1-3-5-8/h6-8H,1-5H2
InChI key:InChIKey=LOQRLYGDFIYONJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C(F)=C1)C2CCCCC2
Synonyms:- Methanone, cyclohexyl(3,4,5-trifluorophenyl)-
- Cyclohexyl(3,4,5-trifluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.