CAS 898769-68-1

(2-Methoxyphenyl)[4-(4-morpholinylmethyl)phenyl]methanone

Description:

(2-Methoxyphenyl)[4-(4-morpholinylmethyl)phenyl]methanone, with CAS number 898769-68-1, is an organic compound characterized by its complex structure, which includes a methoxy group and a morpholine moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high lipophilicity, which can influence its solubility in organic solvents. The presence of the methoxy group may enhance its electron-donating characteristics, potentially affecting its reactivity and interaction with biological targets. The morpholine ring contributes to the compound's potential pharmacological properties, as morpholines are often found in various pharmaceuticals due to their ability to form hydrogen bonds and interact with biological systems. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development, although specific biological activity would require further investigation.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1S/C19H21NO3/c1-22-18-5-3-2-4-17(18)19(21)16-8-6-15(7-9-16)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3

InChI key: InChIKey=NBXGICXHJZMUAD-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC)C=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Methanone, (2-methoxyphenyl)[4-(4-morpholinylmethyl)phenyl]-
• 2-Methoxy-4′-morpholinomethyl benzophenone
• (2-Methoxyphenyl)[4-(4-morpholinylmethyl)phenyl]methanone

2-methoxy-4′-morpholinomethyl benzophenone

CAS: 898769-68-1

Formula: C₁₉H₂₁NO₃

Purity: 97.0%

Molecular weight: 311.381

Ref: 10-F204204