CAS 898769-73-8

4-[3-(2-Methoxyphenyl)-1-oxopropyl]benzonitrile

Description:

4-[3-(2-Methoxyphenyl)-1-oxopropyl]benzonitrile, with the CAS number 898769-73-8, is an organic compound characterized by its complex structure that includes a benzonitrile moiety and a propanoyl group substituted with a methoxyphenyl group. This compound typically exhibits properties common to aromatic nitriles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitrile functional group. The methoxy group enhances its lipophilicity, which may influence its biological activity and interaction with various targets. The presence of multiple functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structure may allow for various synthetic modifications, making it a versatile intermediate in organic synthesis. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a significant interest in the field of organic chemistry and drug development.

Formula: C₁₇H₁₅NO₂

InChI: InChI=1S/C17H15NO2/c1-20-17-5-3-2-4-15(17)10-11-16(19)14-8-6-13(12-18)7-9-14/h2-9H,10-11H2,1H3

InChI key: InChIKey=IIFYFWUITBIMRK-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC=C(C#N)C=C1)C2=C(OC)C=CC=C2

Synonyms:

• 4-[3-(2-Methoxyphenyl)-1-oxopropyl]benzonitrile
• Benzonitrile, 4-[3-(2-methoxyphenyl)-1-oxopropyl]-

4′-cyano-3-(2-methoxyphenyl)propiophenone

CAS: 898769-73-8

Formula: C₁₇H₁₅NO₂

Purity: 97.0%

Molecular weight: 265.312

Ref: 10-F205785