CAS 898769-74-9
:2-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile
Description:
2-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile, with the CAS number 898769-74-9, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a morpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the morpholine ring suggests it may have favorable interactions with biological targets, potentially enhancing its solubility and bioavailability. Additionally, the benzonitrile component indicates that it may possess certain electronic properties, making it useful in various chemical reactions or as a building block in organic synthesis. Its molecular structure may also confer specific reactivity patterns, which can be exploited in drug design or material science. Overall, this compound's unique characteristics stem from its functional groups, which influence its chemical behavior and potential applications in various fields.
Formula:C19H18N2O2
InChI:InChI=1S/C19H18N2O2/c20-13-17-3-1-2-4-18(17)19(22)16-7-5-15(6-8-16)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2
InChI key:InChIKey=WGZGCIHFMBBQNN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C#N)C=CC=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:- 2-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile
- Benzonitrile, 2-[4-(4-morpholinylmethyl)benzoyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.