CAS 898769-76-1

3-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile

Description:

3-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile, with the CAS number 898769-76-1, is a synthetic organic compound characterized by its complex structure, which includes a benzoyl group and a morpholine moiety. This compound typically exhibits properties common to aromatic nitriles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitrile functional group. The morpholine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit specific interactions with biological targets, which can be explored for pharmaceutical applications. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical properties. Additionally, the presence of multiple aromatic rings may enhance its stability and lipophilicity, impacting its behavior in biological systems. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and related fields.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1S/C19H18N2O2/c20-13-16-2-1-3-18(12-16)19(22)17-6-4-15(5-7-17)14-21-8-10-23-11-9-21/h1-7,12H,8-11,14H2

InChI key: InChIKey=JYAHJNNTCCMUGF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C#N)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Benzonitrile, 3-[4-(4-morpholinylmethyl)benzoyl]-
• 3-[4-(4-Morpholinylmethyl)benzoyl]benzonitrile

3-cyano-4′-morpholinomethyl benzophenone

CAS: 898769-76-1

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F204208