CAS 898769-77-2

Ethyl 3-[3-(2-methoxyphenyl)-1-oxopropyl]benzoate

Description:

Ethyl 3-[3-(2-methoxyphenyl)-1-oxopropyl]benzoate, identified by its CAS number 898769-77-2, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. This compound features a complex structure that includes a benzoate moiety and a propyl chain with a ketone group, contributing to its potential reactivity and biological activity. The presence of the methoxyphenyl group suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions. Ethyl 3-[3-(2-methoxyphenyl)-1-oxopropyl]benzoate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, making it a candidate for further investigation in synthetic and applied chemistry contexts.

Formula: C₁₉H₂₀O₄

InChI: InChI=1S/C19H20O4/c1-3-23-19(21)16-9-6-8-15(13-16)17(20)12-11-14-7-4-5-10-18(14)22-2/h4-10,13H,3,11-12H2,1-2H3

InChI key: InChIKey=ITOAAKWHRDFMTP-UHFFFAOYSA-N

SMILES: C(CCC1=C(OC)C=CC=C1)(=O)C2=CC(C(OCC)=O)=CC=C2

Synonyms:

• Benzoic acid, 3-[3-(2-methoxyphenyl)-1-oxopropyl]-, ethyl ester
• Ethyl 3-[3-(2-methoxyphenyl)-1-oxopropyl]benzoate

3′-carboethoxy-3-(2-methoxyphenyl)propiophenone

CAS: 898769-77-2

Formula: C₁₉H₂₀O₄

Purity: 97.0%

Molecular weight: 312.365

Ref: 10-F205787