CymitQuimica logo

CAS 898769-78-3

:

4-[4-(morpholinomethyl)benzoyl]benzonitrile

Description:
4-[4-(Morpholinomethyl)benzoyl]benzonitrile, with the CAS number 898769-78-3, is a chemical compound characterized by its complex structure that includes a benzoyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate due to its functional groups. The presence of the morpholine ring suggests that it may have basic properties, while the nitrile group can contribute to its polarity and potential for hydrogen bonding. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.
Formula:C19H18N2O2
InChI:InChI=1/C19H18N2O2/c20-13-15-1-5-17(6-2-15)19(22)18-7-3-16(4-8-18)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2
SMILES:c1cc(ccc1C#N)C(=O)c1ccc(cc1)CN1CCOCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.