CymitQuimica logo

CAS 898769-80-7

:

Ethyl 2-[4-(4-morpholinylmethyl)benzoyl]benzoate

Description:
Ethyl 2-[4-(4-morpholinylmethyl)benzoyl]benzoate, with the CAS number 898769-80-7, is an organic compound characterized by its complex structure that includes an ethyl ester group and a morpholine moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while having limited solubility in water due to its hydrophobic aromatic components. The presence of the morpholine ring suggests potential for biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit moderate to high stability under standard conditions, although it should be handled with care due to the potential for reactivity with strong acids or bases. Its applications may extend to fields such as pharmaceuticals, agrochemicals, or as a building block in organic synthesis.
Formula:C21H23NO4
InChI:InChI=1S/C21H23NO4/c1-2-26-21(24)19-6-4-3-5-18(19)20(23)17-9-7-16(8-10-17)15-22-11-13-25-14-12-22/h3-10H,2,11-15H2,1H3
InChI key:InChIKey=VKGGCGGNNWWWJC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(OCC)=O)C=CC=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:
  • Ethyl 2-[4-(4-morpholinylmethyl)benzoyl]benzoate
  • Benzoic acid, 2-[4-(4-morpholinylmethyl)benzoyl]-, ethyl ester
Found 1 products.