CAS 898769-82-9
:Ethyl 3-[4-(4-morpholinylmethyl)benzoyl]benzoate
Description:
Ethyl 3-[4-(4-morpholinylmethyl)benzoyl]benzoate, with the CAS number 898769-82-9, is an organic compound characterized by its complex structure, which includes an ethyl ester group and a morpholine moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The presence of the morpholine ring suggests potential biological activity, as morpholine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, although it should be handled with care due to potential reactivity with strong acids or bases. Overall, this compound's unique structure may confer specific applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis.
Formula:C21H23NO4
InChI:InChI=1S/C21H23NO4/c1-2-26-21(24)19-5-3-4-18(14-19)20(23)17-8-6-16(7-9-17)15-22-10-12-25-13-11-22/h3-9,14H,2,10-13,15H2,1H3
InChI key:InChIKey=NIHDFQXXMKJHKP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C(OCC)=O)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:- Benzoic acid, 3-[4-(4-morpholinylmethyl)benzoyl]-, ethyl ester
- Ethyl 3-[4-(4-morpholinylmethyl)benzoyl]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.