CAS 898769-86-3

(2-methylsulfanylphenyl)-[4-(morpholinomethyl)phenyl]methanone

Description:

The chemical substance known as (2-methylsulfanylphenyl)-[4-(morpholinomethyl)phenyl]methanone, with the CAS number 898769-86-3, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a morpholine moiety. This compound features a phenyl ring substituted with a methylthio group, enhancing its potential for biological activity. The presence of the morpholinomethyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates potential lipophilicity, which may influence its solubility and permeability properties. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it suitable for various applications in drug development or as a chemical intermediate. As with many organic compounds, its stability, reactivity, and biological activity would depend on environmental conditions and the presence of other reactants. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₉H₂₁NO₂S

InChI: InChI=1/C19H21NO2S/c1-23-18-5-3-2-4-17(18)19(21)16-8-6-15(7-9-16)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3

SMILES: CSc1ccccc1C(=O)c1ccc(cc1)CN1CCOCC1

4′-morpholinomethyl-2-thiomethylbenzophenone

CAS: 898769-86-3

Formula: C₁₉H₂₁NO₂S

Purity: 97.0%

Molecular weight: 327.44

Ref: 10-F204213