CAS 898769-87-4

1-(4-bromophenyl)-3-(2-methoxyphenyl)propan-1-one

Description:

1-(4-bromophenyl)-3-(2-methoxyphenyl)propan-1-one, with the CAS number 898769-87-4, is an organic compound characterized by its structure, which includes a propanone backbone substituted with a bromophenyl group and a methoxyphenyl group. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic groups. The presence of the bromine atom may impart unique reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. Additionally, the methoxy group can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₆H₁₅BrO₂

InChI: InChI=1/C16H15BrO2/c1-19-16-5-3-2-4-13(16)8-11-15(18)12-6-9-14(17)10-7-12/h2-7,9-10H,8,11H2,1H3

SMILES: COc1ccccc1CCC(=O)c1ccc(cc1)Br