CymitQuimica logo

CAS 898769-88-5

:

(4-methylsulfanylphenyl)-[4-(morpholinomethyl)phenyl]methanone

Description:
The chemical substance known as (4-methylsulfanylphenyl)-[4-(morpholinomethyl)phenyl]methanone, with the CAS number 898769-88-5, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and a morpholine moiety. This compound features a phenyl ring substituted with a methylsulfanyl group, enhancing its potential for various chemical interactions. The presence of the morpholinomethyl group suggests potential applications in medicinal chemistry, particularly in drug design, due to the morpholine's ability to influence pharmacokinetics and receptor binding. The compound's molecular structure indicates it may exhibit specific biological activities, making it of interest for research in areas such as pharmacology and biochemistry. Additionally, its solubility and stability in various solvents can be influenced by the functional groups present, which is crucial for its application in formulations or as a reagent in chemical reactions. Overall, this compound represents a unique combination of functional groups that may contribute to its reactivity and potential applications in various fields.
Formula:C19H21NO2S
InChI:InChI=1/C19H21NO2S/c1-23-18-8-6-17(7-9-18)19(21)16-4-2-15(3-5-16)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.