CAS 898769-90-9

Methanone, (3-bromophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3-bromophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom at the 3-position of one phenyl ring contributes to its reactivity and potential applications in medicinal chemistry. The compound also features a morpholine group, which is a six-membered ring containing both nitrogen and oxygen, enhancing its solubility and biological activity. This compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways, making it of interest in pharmaceutical research. Its molecular structure suggests that it could interact with biological targets, possibly influencing cellular processes. The specific arrangement of substituents on the phenyl rings can affect its electronic properties and steric hindrance, which are crucial for its function in biological systems. Overall, Methanone, (3-bromophenyl)[4-(4-morpholinylmethyl)phenyl]- is a compound of interest for further investigation in drug development and chemical synthesis.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1/C18H18BrNO2/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=GKFMSGJEXMCFAH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• (3-Bromophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• 3-Bromo-4′-morpholinomethyl benzophenone
• Methanone, (3-bromophenyl)[4-(4-morpholinylmethyl)phenyl]-