CAS 898769-92-1

Methanone, (4-bromophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-bromophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of a bromine atom on one of the phenyl rings contributes to its reactivity and potential applications in various chemical reactions. The morpholine moiety indicates that the compound contains a cyclic amine, which can enhance its solubility and biological activity. This compound may exhibit interesting pharmacological properties due to the combination of the bromophenyl and morpholinyl groups, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest in synthetic organic chemistry. Overall, Methanone, (4-bromophenyl)[4-(4-morpholinylmethyl)phenyl]- represents a unique chemical entity with potential utility in various scientific fields.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1S/C18H18BrNO2/c19-17-7-5-16(6-8-17)18(21)15-3-1-14(2-4-15)13-20-9-11-22-12-10-20/h1-8H,9-13H2

InChI key: InChIKey=YGLRGKKCMKQBIC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(Br)C=C3

Synonyms:

• Methanone, (4-bromophenyl)[4-(4-morpholinylmethyl)phenyl]-
• 4-Bromo-4′-morpholinomethyl benzophenone
• (4-Bromophenyl)[4-(4-morpholinylmethyl)phenyl]methanone

4-bromo-4′-morpholinomethyl benzophenone

CAS: 898769-92-1

Formula: C₁₈H₁₈BrNO₂

Purity: 97.0%

Molecular weight: 360.251

Ref: 10-F204216