CAS 898769-94-3

(3-Chlorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone

Description:

(3-Chlorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone, with the CAS number 898769-94-3, is a synthetic organic compound characterized by its complex structure, which includes a chlorophenyl group and a morpholinylmethyl substituent. This compound typically exhibits properties common to ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to its hydrophobic aromatic components, while its polar morpholine group may impart some degree of solubility in polar solvents. The presence of the chlorophenyl moiety suggests potential biological activity, making it of interest in pharmaceutical research. Additionally, the morpholine ring can contribute to the compound's ability to interact with biological targets, potentially influencing its pharmacokinetic properties. Safety and handling considerations should be taken into account, as with many organic compounds, including proper storage and disposal methods to mitigate any environmental or health risks.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=XBHJBPWNYLXVHD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• 3-Chloro-4′-morpholinomethyl benzophenone
• (3-Chlorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (3-chlorophenyl)[4-(4-morpholinylmethyl)phenyl]-

(3-Chlorophenyl)(4-morpholin-4-ylmethylphenyl)methanone

CAS: 898769-94-3

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F049233