CAS 898769-97-6

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2-methoxyphenyl)-

Description:

1-Propanone, 1-(2,3-dimethylphenyl)-3-(2-methoxyphenyl)-, also known by its CAS number 898769-97-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 2-methoxyphenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in reactivity and solubility. Generally, compounds of this nature exhibit moderate polarity due to the presence of the ketone group, which can engage in hydrogen bonding. The aromatic rings may impart stability and influence the compound's electronic properties. Additionally, the presence of methyl and methoxy groups can affect the compound's sterics and electronic distribution, potentially impacting its behavior in chemical reactions and interactions with biological systems. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would depend on its concentration and exposure levels.

Formula: C₁₈H₂₀O₂

InChI: InChI=1S/C18H20O2/c1-13-7-6-9-16(14(13)2)17(19)12-11-15-8-4-5-10-18(15)20-3/h4-10H,11-12H2,1-3H3

InChI key: InChIKey=VUCQTXNQXSRQTR-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(C)C(C)=CC=C1)C2=C(OC)C=CC=C2

Synonyms:

• 1-Propanone, 1-(2,3-dimethylphenyl)-3-(2-methoxyphenyl)-
• 1-(2,3-Dimethylphenyl)-3-(2-methoxyphenyl)-1-propanone
• 2′,3′-Dimethyl-3-(2-methoxyphenyl)propiophenone

2′,3′-dimethyl-3-(2-methoxyphenyl)propiophenone

CAS: 898769-97-6

Formula: C₁₈H₂₀O₂

Purity: 97.0%

Molecular weight: 268.356

Ref: 10-F205797