CAS 898769-98-7

Methanone, (3-fluorophenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3-fluorophenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a fluorine atom on the 3-position of the phenyl ring contributes to its electronic properties, potentially influencing its reactivity and interactions with biological targets. The compound also features a morpholine moiety, which is a six-membered ring containing both nitrogen and oxygen, enhancing its solubility and biological activity. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the morpholine group is often associated with improved pharmacokinetic properties. The compound's CAS number, 898769-98-7, allows for its identification in chemical databases, facilitating research and development efforts. Overall, the unique combination of functional groups and structural features in this compound may lead to interesting chemical behavior and potential therapeutic applications.

Formula: C₁₈H₁₈FNO₂

InChI: InChI=1S/C18H18FNO2/c19-17-3-1-2-16(12-17)18(21)15-6-4-14(5-7-15)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=DCJUBUUNPZQNEM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• (3-Fluorophenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• 3-Fluoro-4′-morpholinomethyl benzophenone
• Methanone, (3-fluorophenyl)[4-(4-morpholinylmethyl)phenyl]-

3-fluoro-4′-morpholinomethyl benzophenone

CAS: 898769-98-7

Formula: C₁₈H₁₈FNO₂

Purity: 97.0%

Molecular weight: 299.345

Ref: 10-F204218