CAS 898770-05-3

Methanone, (2,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, contributing to its hydrophobic characteristics. The compound also features a morpholinylmethyl substituent, which introduces a morpholine ring—a six-membered ring containing both oxygen and nitrogen atoms—enhancing its potential for biological activity and solubility in polar solvents. This compound may exhibit properties typical of both ketones and aromatic compounds, such as stability under certain conditions and potential reactivity in electrophilic substitution reactions. Its unique structure suggests possible applications in pharmaceuticals or as a chemical intermediate, although specific biological activities or uses would require further investigation. Overall, the compound's characteristics are defined by its functional groups, molecular geometry, and the presence of both hydrophobic and hydrophilic regions.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-3-8-19(16(2)13-15)20(22)18-6-4-17(5-7-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=YWMFIORVIMASLR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=C(C)C=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Methanone, (2,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-
• (2,4-Dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• 2,4-Dimethyl-4′-morpholinomethyl benzophenone

2,4-dimethyl-4′-morpholinomethyl benzophenone

CAS: 898770-05-3

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204221