CAS 898770-08-6

Methanone, (2,5-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that it has two methyl substituents on the aromatic ring, which can influence its reactivity and physical properties. The compound also features a morpholine moiety, a six-membered ring containing both nitrogen and oxygen, which contributes to its potential biological activity and solubility characteristics. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, which may affect its interaction with biological systems. Additionally, the presence of the morpholine group may enhance its ability to form hydrogen bonds, influencing its solubility in various solvents. Overall, Methanone, (2,5-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]- is a structurally diverse compound that may have applications in medicinal chemistry or material science, depending on its specific properties and reactivity.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-3-4-16(2)19(13-15)20(22)18-7-5-17(6-8-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=IJIZPRXEMZZLMN-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=CC(C)=C1)C2=CC=C(CN3CCOCC3)C=C2

Synonyms:

• Methanone, (2,5-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-
• (2,5-Dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]methanone
• 2,5-Dimethyl-4′-morpholinomethyl benzophenone

2,5-dimethyl-4′-morpholinomethyl benzophenone

CAS: 898770-08-6

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F204222