CAS 898770-12-2
:1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(2-methoxyphenyl)-
Description:
1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(2-methoxyphenyl)-, identified by CAS number 898770-12-2, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromo-3-fluorophenyl group and a 2-methoxyphenyl group. The presence of bromine and fluorine atoms introduces halogen substituents that can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The methoxy group contributes to the compound's electron-donating properties, potentially affecting its solubility and interaction with other molecules. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry and material science. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, where the unique combination of functional groups can lead to specific interactions with biological targets or materials.
Formula:C16H14BrFO2
InChI:InChI=1S/C16H14BrFO2/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3
InChI key:InChIKey=IEIMHRCOMYEVHE-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=C(Br)C=C1)C2=C(OC)C=CC=C2
Synonyms:- 4′-Bromo-3′-fluoro-3-(2-methoxyphenyl)propiophenone
- 1-(4-Bromo-3-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone
- 1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.