CymitQuimica logo

CAS 898770-14-4

:

Methanone, (3,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-

Description:
Methanone, (3,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 3,4-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic characteristics. The compound also features a morpholine moiety, which is a six-membered ring containing both oxygen and nitrogen, contributing to its potential biological activity and solubility properties. This structure suggests that the compound may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in various biochemical pathways. The molecular interactions are influenced by the steric and electronic effects of the substituents, which can affect its reactivity and binding affinity in biological systems. Overall, Methanone, (3,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]- is a compound of interest in medicinal chemistry and drug development, warranting further investigation into its potential applications.
Formula:C20H23NO2
InChI:InChI=1S/C20H23NO2/c1-15-3-6-19(13-16(15)2)20(22)18-7-4-17(5-8-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3
InChI key:InChIKey=LKMNIDRPZDCAPB-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(C)C=C1)C2=CC=C(CN3CCOCC3)C=C2
Synonyms:
  • Methanone, (3,4-dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]-
  • (3,4-Dimethylphenyl)[4-(4-morpholinylmethyl)phenyl]methanone
  • 3,4-Dimethyl-4′-morpholinomethyl benzophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.