CAS 898770-15-5

1-(4-Chloro-3-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone

Description:

1-(4-Chloro-3-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone, identified by its CAS number 898770-15-5, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound contains a chloro and a fluorine substituent on the phenyl ring, which can influence its reactivity and physical properties. The presence of a methoxy group on the second phenyl ring enhances its lipophilicity and may affect its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogen substituents. Additionally, the compound's solubility, stability, and reactivity can vary based on the functional groups present, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1S/C16H14ClFO2/c1-20-16-5-3-2-4-11(16)7-9-15(19)12-6-8-13(17)14(18)10-12/h2-6,8,10H,7,9H2,1H3

InChI key: InChIKey=ZNTCGLUZDAMBAQ-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(F)=C(Cl)C=C1)C2=C(OC)C=CC=C2

Synonyms:

• 4′-Chloro-3′-fluoro-3-(2-methoxyphenyl)propiophenone
• 1-Propanone, 1-(4-chloro-3-fluorophenyl)-3-(2-methoxyphenyl)-
• 1-(4-Chloro-3-fluorophenyl)-3-(2-methoxyphenyl)-1-propanone