CAS 898770-16-6

Methanone, (3-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom on one of the phenyl rings contributes to its reactivity and potential applications in various chemical reactions. The compound also features a pyrrolidinylmethyl substituent, which introduces a nitrogen-containing heterocycle, enhancing its biological activity and solubility properties. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of both aromatic and aliphatic components in its structure may influence its physical properties, such as melting point, boiling point, and solubility in different solvents. Overall, Methanone, (3-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- represents a unique chemical entity with potential utility in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₈H₁₈BrNO

InChI: InChI=1S/C18H18BrNO/c19-17-8-4-7-16(12-17)18(21)15-6-3-5-14(11-15)13-20-9-1-2-10-20/h3-8,11-12H,1-2,9-10,13H2

InChI key: InChIKey=RYNJPCGDZLBCIU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(Br)=CC=C3

Synonyms:

• 3-Bromo-3′-pyrrolidinomethyl benzophenone
• Methanone, (3-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
• (3-Bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone