CAS 898770-19-9

Methanone, (4-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (4-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions. The compound features a pyrrolidine moiety, which is a five-membered nitrogen-containing ring, indicating potential biological activity and interaction with biological systems. This structure suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular interactions could be influenced by the electron-withdrawing nature of the bromine atom and the steric effects of the pyrrolidinylmethyl group. Additionally, its solubility and stability in different solvents can vary based on the functional groups present. Overall, this compound's unique characteristics make it a subject of interest for further research in organic synthesis and drug development.

Formula: C₁₈H₁₈BrNO

InChI: InChI=1/C18H18BrNO/c19-17-8-6-15(7-9-17)18(21)16-5-3-4-14(12-16)13-20-10-1-2-11-20/h3-9,12H,1-2,10-11,13H2

InChI key: InChIKey=JOMIDXITRZUFCX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC=C(Br)C=C3

Synonyms:

• (4-Bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone
• 4′-Bromo-3-pyrrolidinomethyl benzophenone
• Methanone, (4-bromophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

4′-bromo-3-pyrrolidinomethyl benzophenone

CAS: 898770-19-9

Formula: C₁₈H₁₈BrNO

Purity: 97.0%

Molecular weight: 344.252

Ref: 10-F204784