CAS 898770-20-2
:(4-bromo-3-fluoro-phenyl)-[4-(morpholinomethyl)phenyl]methanone
Description:
(4-bromo-3-fluoro-phenyl)-[4-(morpholinomethyl)phenyl]methanone, with the CAS number 898770-20-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as a morpholinomethyl group. This compound typically exhibits properties associated with aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the presence of halogen substituents. The morpholine moiety may impart solubility in polar solvents and influence biological activity, making it of interest in medicinal chemistry. The presence of halogens can also enhance lipophilicity and alter the compound's pharmacokinetic properties. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, this compound's unique functional groups and structural features suggest potential applications in drug development and materials science.
Formula:C18H17BrFNO2
InChI:InChI=1/C18H17BrFNO2/c19-16-6-5-15(11-17(16)20)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
SMILES:c1cc(ccc1CN1CCOCC1)C(=O)c1ccc(c(c1)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.