CAS 898770-28-0

Methanone, (3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-

Description:

Methanone, (3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. The presence of a fluorine atom on one of the phenyl rings contributes to its electronic properties, potentially influencing its reactivity and interaction with biological systems. The compound also features a pyrrolidinylmethyl substituent, which introduces a cyclic amine structure that may enhance its pharmacological properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can affect its solubility and permeability in biological membranes. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, making it of interest in medicinal chemistry and drug development. Its specific applications and biological activity would depend on further studies, including its interaction with biological targets and its pharmacokinetic profile. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₈FNO

InChI: InChI=1/C18H18FNO/c19-17-8-4-7-16(12-17)18(21)15-6-3-5-14(11-15)13-20-9-1-2-10-20/h3-8,11-12H,1-2,9-10,13H2

InChI key: InChIKey=RXAIYJPXQAHPSN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCCC2)=CC=C1)C3=CC(F)=CC=C3

Synonyms:

• Methanone, (3-fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]-
• (3-Fluorophenyl)[3-(1-pyrrolidinylmethyl)phenyl]methanone

3-fluoro-3′-pyrrolidinomethyl benzophenone

CAS: 898770-28-0

Formula: C₁₈H₁₈FNO

Purity: 97.0%

Molecular weight: 283.346

Ref: 10-F204787