CAS 898770-30-4
:3-(2-Methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone
Description:
3-(2-Methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone, with CAS number 898770-30-4, is an organic compound characterized by its complex structure featuring a propanone backbone. This compound includes a methoxy group attached to a phenyl ring, which contributes to its aromatic properties and potential reactivity. The presence of a trifluoromethyl group on another phenyl ring enhances its lipophilicity and can influence its electronic properties, making it of interest in various chemical applications, including medicinal chemistry and material science. The trifluoromethyl group is known for imparting unique characteristics such as increased metabolic stability and altered pharmacokinetics in drug design. Additionally, the compound may exhibit interesting photophysical properties due to its aromatic system, which can be relevant in fields like organic electronics or photochemistry. Overall, this compound's unique functional groups and structural features make it a subject of interest for further research and potential applications in various chemical domains.
Formula:C17H15F3O2
InChI:InChI=1S/C17H15F3O2/c1-22-16-8-3-2-5-12(16)9-10-15(21)13-6-4-7-14(11-13)17(18,19)20/h2-8,11H,9-10H2,1H3
InChI key:InChIKey=MRMBDULAQJGHNN-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(C(F)(F)F)=CC=C1)C2=C(OC)C=CC=C2
Synonyms:- 1-Propanone, 3-(2-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-
- 3-(2-Methoxyphenyl)-3′-trifluoromethylpropiophenone
- 3-(2-Methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.